C13H19N5O — CID 106186033
2,3-dimethyl-3-[(1-phenyltetrazol-5-yl)amino]butan-2-ol (PubChem CID 106186033) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 2,3-dimethyl-3-[(1-phenyltetrazol-5-yl)amino]butan-2-ol.
| Compound Name | 2,3-dimethyl-3-[(1-phenyltetrazol-5-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 106186033 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2,3-dimethyl-3-[(1-phenyltetrazol-5-yl)amino]butan-2-ol |
| SMILES | CC(C)(O)C(C)(C)Nc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C13H19N5O/c1-12(2,13(3,4)19)14-11-15-16-17-18(11)10-8-6-5-7-9-10/h5-9,19H,1-4H3,(H,14,15,17) |
| InChIKey | ALNJESVUYOMAKL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |