C14H11N5O2 — CID 43172025
4-[(1-phenyltetrazol-5-yl)amino]benzoic acid (PubChem CID 43172025) has the molecular formula C14H11N5O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is 4-[(1-phenyltetrazol-5-yl)amino]benzoic acid.
| Compound Name | 4-[(1-phenyltetrazol-5-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 43172025 |
| Molecular Formula | C14H11N5O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-[(1-phenyltetrazol-5-yl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H11N5O2/c20-13(21)10-6-8-11(9-7-10)15-14-16-17-18-19(14)12-4-2-1-3-5-12/h1-9H,(H,20,21)(H,15,16,18) |
| InChIKey | KNOATXIRNKJBFE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |