C19H17N7O2 — CID 117076249
ethyl 3-[4-[(1-phenyltetrazol-5-yl)amino]pyrazol-1-yl]benzoate (PubChem CID 117076249) has the molecular formula C19H17N7O2 and a molecular weight of 375.39 g/mol. Its IUPAC name is ethyl 3-[4-[(1-phenyltetrazol-5-yl)amino]pyrazol-1-yl]benzoate.
| Compound Name | ethyl 3-[4-[(1-phenyltetrazol-5-yl)amino]pyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 117076249 |
| Molecular Formula | C19H17N7O2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | ethyl 3-[4-[(1-phenyltetrazol-5-yl)amino]pyrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2cc(Nc3nnnn3-c3ccccc3)cn2)c1 |
| InChI | InChI=1S/C19H17N7O2/c1-2-28-18(27)14-7-6-10-17(11-14)25-13-15(12-20-25)21-19-22-23-24-26(19)16-8-4-3-5-9-16/h3-13H,2H2,1H3,(H,21,22,24) |
| InChIKey | GCHIAFDXRXSZEQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |