C24H24N4O4 — CID 161129346
ethyl 4-methyl-1-phenylpyrazole-5-carboxylate;4-methyl-1-phenylpyrazole-5-carboxylic acid (PubChem CID 161129346) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is ethyl 4-methyl-1-phenylpyrazole-5-carboxylate;4-methyl-1-phenylpyrazole-5-carboxylic acid.
| Compound Name | ethyl 4-methyl-1-phenylpyrazole-5-carboxylate;4-methyl-1-phenylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 161129346 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | ethyl 4-methyl-1-phenylpyrazole-5-carboxylate;4-methyl-1-phenylpyrazole-5-carboxylic acid |
| SMILES | CCOC(=O)c1c(C)cnn1-c1ccccc1.Cc1cnn(-c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C13H14N2O2.C11H10N2O2/c1-3-17-13(16)12-10(2)9-14-15(12)11-7-5-4-6-8-11;1-8-7-12-13(10(8)11(14)15)9-5-3-2-4-6-9/h4-9H,3H2,1-2H3;2-7H,1H3,(H,14,15) |
| InChIKey | ULZAJXSGPBWOTK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |