C24H23N5O3 — CID 43072027
ethyl 5-methyl-1-[4-[[2-(1-phenylpyrazol-4-yl)acetyl]amino]phenyl]pyrazole-4-carboxylate (PubChem CID 43072027) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is ethyl 5-methyl-1-[4-[[2-(1-phenylpyrazol-4-yl)acetyl]amino]phenyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-1-[4-[[2-(1-phenylpyrazol-4-yl)acetyl]amino]phenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 43072027 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | ethyl 5-methyl-1-[4-[[2-(1-phenylpyrazol-4-yl)acetyl]amino]phenyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(NC(=O)Cc3cnn(-c4ccccc4)c3)cc2)c1C |
| InChI | InChI=1S/C24H23N5O3/c1-3-32-24(31)22-15-26-29(17(22)2)21-11-9-19(10-12-21)27-23(30)13-18-14-25-28(16-18)20-7-5-4-6-8-20/h4-12,14-16H,3,13H2,1-2H3,(H,27,30) |
| InChIKey | VXJMGMUPKLWGMJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |