C20H24FN7 — CID 133294032
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-phenyltetrazol-5-amine (PubChem CID 133294032) has the molecular formula C20H24FN7 and a molecular weight of 381.46 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-phenyltetrazol-5-amine.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 133294032 |
| Molecular Formula | C20H24FN7 |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-phenyltetrazol-5-amine |
| SMILES | Fc1ccccc1N1CCN(CCCNc2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24FN7/c21-18-9-4-5-10-19(18)27-15-13-26(14-16-27)12-6-11-22-20-23-24-25-28(20)17-7-2-1-3-8-17/h1-5,7-10H,6,11-16H2,(H,22,23,25) |
| InChIKey | LXSSKANKKLQNQF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|