C7H14N4 — CID 63963092
N'-(2-methylpyrazol-3-yl)propane-1,3-diamine (PubChem CID 63963092) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is N'-(2-methylpyrazol-3-yl)propane-1,3-diamine.
| Compound Name | N'-(2-methylpyrazol-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 63963092 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | N'-(2-methylpyrazol-3-yl)propane-1,3-diamine |
| SMILES | Cn1nccc1NCCCN |
| InChI | InChI=1S/C7H14N4/c1-11-7(3-6-10-11)9-5-2-4-8/h3,6,9H,2,4-5,8H2,1H3 |
| InChIKey | UHEWHCFMJOGEOR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|