C9H16N4 — CID 103542644
N'-(2-methylpyrazol-3-yl)-N-prop-2-enylethane-1,2-diamine (PubChem CID 103542644) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N'-(2-methylpyrazol-3-yl)-N-prop-2-enylethane-1,2-diamine.
| Compound Name | N'-(2-methylpyrazol-3-yl)-N-prop-2-enylethane-1,2-diamine |
|---|---|
| PubChem CID | 103542644 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N'-(2-methylpyrazol-3-yl)-N-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCNCCNc1ccnn1C |
| InChI | InChI=1S/C9H16N4/c1-3-5-10-7-8-11-9-4-6-12-13(9)2/h3-4,6,10-11H,1,5,7-8H2,2H3 |
| InChIKey | LWICWTIRTOICRK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|