About 2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine
2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine (PubChem CID 103542631) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | 2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine |
| PubChem CID | 103542631 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine |
| SMILES | CC(CN)CNc1ccnn1C |
| InChI | InChI=1S/C8H16N4/c1-7(5-9)6-10-8-3-4-11-12(8)2/h3-4,7,10H,5-6,9H2,1-2H3 |
| InChIKey | FBAIFRQHCPHEDD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine?
The IUPAC name of 2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine (CID 103542631) is 2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine.
What is the SMILES notation for 2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine?
The canonical SMILES for 2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine is CC(CN)CNc1ccnn1C.
What is the InChIKey of 2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine?
The InChIKey is FBAIFRQHCPHEDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-7(5-9)6-10-8-3-4-11-12(8)2/h3-4,7,10H,5-6,9H2,1-2H3.
What are the key properties of 2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine?
2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine has a molecular weight of 168.24 g/mol, XLogP of 0.43, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N'-(2-methylpyrazol-3-yl)propane-1,3-diamine is sourced from PubChem (CID 103542631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).