C21H16N6 — CID 44535685
9-methyl-2-naphthalen-2-yl-N-pyridin-4-ylpurin-6-amine (PubChem CID 44535685) has the molecular formula C21H16N6 and a molecular weight of 352.40 g/mol. Its IUPAC name is 9-methyl-2-naphthalen-2-yl-N-pyridin-4-ylpurin-6-amine.
| Compound Name | 9-methyl-2-naphthalen-2-yl-N-pyridin-4-ylpurin-6-amine |
|---|---|
| PubChem CID | 44535685 |
| Molecular Formula | C21H16N6 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 9-methyl-2-naphthalen-2-yl-N-pyridin-4-ylpurin-6-amine |
| SMILES | Cn1cnc2c(Nc3ccncc3)nc(-c3ccc4ccccc4c3)nc21 |
| InChI | InChI=1S/C21H16N6/c1-27-13-23-18-20(24-17-8-10-22-11-9-17)25-19(26-21(18)27)16-7-6-14-4-2-3-5-15(14)12-16/h2-13H,1H3,(H,22,24,25,26) |
| InChIKey | QHHLQFITTIKWRK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |