C32H52N6O7 — CID 70450635
3-[[2-amino-6-(methylamino)purin-9-yl]-dec-8-enoxycarbonyloxymethoxy]propyl dec-8-enyl carbonate (PubChem CID 70450635) has the molecular formula C32H52N6O7 and a molecular weight of 632.80 g/mol. Its IUPAC name is 3-[[2-amino-6-(methylamino)purin-9-yl]-dec-8-enoxycarbonyloxymethoxy]propyl dec-8-enyl carbonate.
| Compound Name | 3-[[2-amino-6-(methylamino)purin-9-yl]-dec-8-enoxycarbonyloxymethoxy]propyl dec-8-enyl carbonate |
|---|---|
| PubChem CID | 70450635 |
| Molecular Formula | C32H52N6O7 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.39 |
| IUPAC Name | 3-[[2-amino-6-(methylamino)purin-9-yl]-dec-8-enoxycarbonyloxymethoxy]propyl dec-8-enyl carbonate |
| SMILES | CC=CCCCCCCCOC(=O)OCCCOC(OC(=O)OCCCCCCCC=CC)n1cnc2c(NC)nc(N)nc21 |
| InChI | InChI=1S/C32H52N6O7/c1-4-6-8-10-12-14-16-18-21-42-31(39)43-24-20-23-41-30(38-25-35-26-27(34-3)36-29(33)37-28(26)38)45-32(40)44-22-19-17-15-13-11-9-7-5-2/h4-7,25,30H,8-24H2,1-3H3,(H3,33,34,36,37) |
| InChIKey | RUKADFIJKWGLNP-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|