C25H24N8OS — CID 117080227
N-[4-[[2-[3-(dimethylamino)anilino]-9-thiophen-3-ylpurin-6-yl]amino]phenyl]acetamide (PubChem CID 117080227) has the molecular formula C25H24N8OS and a molecular weight of 484.59 g/mol. Its IUPAC name is N-[4-[[2-[3-(dimethylamino)anilino]-9-thiophen-3-ylpurin-6-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[2-[3-(dimethylamino)anilino]-9-thiophen-3-ylpurin-6-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 117080227 |
| Molecular Formula | C25H24N8OS |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-[4-[[2-[3-(dimethylamino)anilino]-9-thiophen-3-ylpurin-6-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2nc(Nc3cccc(N(C)C)c3)nc3c2ncn3-c2ccsc2)cc1 |
| InChI | InChI=1S/C25H24N8OS/c1-16(34)27-17-7-9-18(10-8-17)28-23-22-24(33(15-26-22)21-11-12-35-14-21)31-25(30-23)29-19-5-4-6-20(13-19)32(2)3/h4-15H,1-3H3,(H,27,34)(H2,28,29,30,31) |
| InChIKey | NONXQLHWOKMIRH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |