C10H11ClN6 — CID 10824613
5-chloro-N,3-bis(prop-2-enyl)triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 10824613) has the molecular formula C10H11ClN6 and a molecular weight of 250.69 g/mol. Its IUPAC name is 5-chloro-N,3-bis(prop-2-enyl)triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-chloro-N,3-bis(prop-2-enyl)triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 10824613 |
| Molecular Formula | C10H11ClN6 |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 5-chloro-N,3-bis(prop-2-enyl)triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | C=CCNc1nc(Cl)nc2c1nnn2CC=C |
| InChI | InChI=1S/C10H11ClN6/c1-3-5-12-8-7-9(14-10(11)13-8)17(6-4-2)16-15-7/h3-4H,1-2,5-6H2,(H,12,13,14) |
| InChIKey | YLGNUTKJIGMHER-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|