C18H21ClN6 — CID 3228185
5-tert-butyl-3-[(2-chlorophenyl)methyl]-N-prop-2-enyltriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 3228185) has the molecular formula C18H21ClN6 and a molecular weight of 356.86 g/mol. Its IUPAC name is 5-tert-butyl-3-[(2-chlorophenyl)methyl]-N-prop-2-enyltriazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-tert-butyl-3-[(2-chlorophenyl)methyl]-N-prop-2-enyltriazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 3228185 |
| Molecular Formula | C18H21ClN6 |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 5-tert-butyl-3-[(2-chlorophenyl)methyl]-N-prop-2-enyltriazolo[4,5-d]pyrimidin-7-amine |
| SMILES | C=CCNc1nc(C(C)(C)C)nc2c1nnn2Cc1ccccc1Cl |
| InChI | InChI=1S/C18H21ClN6/c1-5-10-20-15-14-16(22-17(21-15)18(2,3)4)25(24-23-14)11-12-8-6-7-9-13(12)19/h5-9H,1,10-11H2,2-4H3,(H,20,21,22) |
| InChIKey | ZCMFVJTURQEQGU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|