C19H23ClN8 — CID 138602906
5-tert-butyl-3-[(2-chlorophenyl)methyl]-7-(1,2,6-triazaspiro[2.4]heptan-6-yl)triazolo[4,5-d]pyrimidine (PubChem CID 138602906) has the molecular formula C19H23ClN8 and a molecular weight of 398.90 g/mol. Its IUPAC name is 5-tert-butyl-3-[(2-chlorophenyl)methyl]-7-(1,2,6-triazaspiro[2.4]heptan-6-yl)triazolo[4,5-d]pyrimidine.
| Compound Name | 5-tert-butyl-3-[(2-chlorophenyl)methyl]-7-(1,2,6-triazaspiro[2.4]heptan-6-yl)triazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 138602906 |
| Molecular Formula | C19H23ClN8 |
| Molecular Weight | 398.90 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 5-tert-butyl-3-[(2-chlorophenyl)methyl]-7-(1,2,6-triazaspiro[2.4]heptan-6-yl)triazolo[4,5-d]pyrimidine |
| SMILES | CC(C)(C)c1nc(N2CCC3(C2)NN3)c2nnn(Cc3ccccc3Cl)c2n1 |
| InChI | InChI=1S/C19H23ClN8/c1-18(2,3)17-21-15(27-9-8-19(11-27)24-25-19)14-16(22-17)28(26-23-14)10-12-6-4-5-7-13(12)20/h4-7,24-25H,8-11H2,1-3H3 |
| InChIKey | GRKURUWQGYXCRL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.90 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|