C21H23F2N7S — CID 138605928
[2-[[5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]phenyl]methyl thiocyanate (PubChem CID 138605928) has the molecular formula C21H23F2N7S and a molecular weight of 443.53 g/mol. Its IUPAC name is [2-[[5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]phenyl]methyl thiocyanate.
| Compound Name | [2-[[5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]phenyl]methyl thiocyanate |
|---|---|
| PubChem CID | 138605928 |
| Molecular Formula | C21H23F2N7S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | [2-[[5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]phenyl]methyl thiocyanate |
| SMILES | CC(C)(C)c1nc(N2CCC(F)(F)C2)c2nnn(Cc3ccccc3CSC#N)c2n1 |
| InChI | InChI=1S/C21H23F2N7S/c1-20(2,3)19-25-17(29-9-8-21(22,23)12-29)16-18(26-19)30(28-27-16)10-14-6-4-5-7-15(14)11-31-13-24/h4-7H,8-12H2,1-3H3 |
| InChIKey | SVZQCRBPURFEIY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 83.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|