About 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine
2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine (PubChem CID 86764913) has the molecular formula C21H25F2N5
and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine.
Molecular Properties
| Compound Name | 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine |
| PubChem CID | 86764913 |
| Molecular Formula | C21H25F2N5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine |
| SMILES | Cc1ccc(Cn2cnc3c(N4CCC(F)(F)C4)nc(C(C)(C)C)nc32)cc1 |
| InChI | InChI=1S/C21H25F2N5/c1-14-5-7-15(8-6-14)11-28-13-24-16-17(27-10-9-21(22,23)12-27)25-19(20(2,3)4)26-18(16)28/h5-8,13H,9-12H2,1-4H3 |
| InChIKey | IGWAAMSVCGBVKT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine?
The IUPAC name of 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine (CID 86764913) is 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine.
What is the SMILES notation for 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine?
The canonical SMILES for 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine is Cc1ccc(Cn2cnc3c(N4CCC(F)(F)C4)nc(C(C)(C)C)nc32)cc1.
What is the InChIKey of 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine?
The InChIKey is IGWAAMSVCGBVKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F2N5/c1-14-5-7-15(8-6-14)11-28-13-24-16-17(27-10-9-21(22,23)12-27)25-19(20(2,3)4)26-18(16)28/h5-8,13H,9-12H2,1-4H3.
What are the key properties of 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine?
2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine has a molecular weight of 385.46 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-9-[(4-methylphenyl)methyl]purine is sourced from PubChem (CID 86764913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).