C19H23ClN6O — CID 86763489
1-[2-tert-butyl-9-[(2-chloro-3-pyridinyl)methyl]purin-6-yl]pyrrolidin-3-ol (PubChem CID 86763489) has the molecular formula C19H23ClN6O and a molecular weight of 386.89 g/mol. Its IUPAC name is 1-[2-tert-butyl-9-[(2-chloro-3-pyridinyl)methyl]purin-6-yl]pyrrolidin-3-ol.
| Compound Name | 1-[2-tert-butyl-9-[(2-chloro-3-pyridinyl)methyl]purin-6-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 86763489 |
| Molecular Formula | C19H23ClN6O |
| Molecular Weight | 386.89 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-[2-tert-butyl-9-[(2-chloro-3-pyridinyl)methyl]purin-6-yl]pyrrolidin-3-ol |
| SMILES | CC(C)(C)c1nc(N2CCC(O)C2)c2ncn(Cc3cccnc3Cl)c2n1 |
| InChI | InChI=1S/C19H23ClN6O/c1-19(2,3)18-23-16(25-8-6-13(27)10-25)14-17(24-18)26(11-22-14)9-12-5-4-7-21-15(12)20/h4-5,7,11,13,27H,6,8-10H2,1-3H3 |
| InChIKey | LWJAWEONGDSKOY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.89 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|