C22H27ClN6O — CID 140702049
2-[(3S)-1-[2-tert-butyl-9-[(2-chlorophenyl)methyl]purin-6-yl]pyrrolidin-3-yl]acetamide (PubChem CID 140702049) has the molecular formula C22H27ClN6O and a molecular weight of 426.95 g/mol. Its IUPAC name is 2-[(3S)-1-[2-tert-butyl-9-[(2-chlorophenyl)methyl]purin-6-yl]pyrrolidin-3-yl]acetamide.
| Compound Name | 2-[(3S)-1-[2-tert-butyl-9-[(2-chlorophenyl)methyl]purin-6-yl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 140702049 |
| Molecular Formula | C22H27ClN6O |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-[(3S)-1-[2-tert-butyl-9-[(2-chlorophenyl)methyl]purin-6-yl]pyrrolidin-3-yl]acetamide |
| SMILES | CC(C)(C)c1nc(N2CC[C@@H](CC(N)=O)C2)c2ncn(Cc3ccccc3Cl)c2n1 |
| InChI | InChI=1S/C22H27ClN6O/c1-22(2,3)21-26-19(28-9-8-14(11-28)10-17(24)30)18-20(27-21)29(13-25-18)12-15-6-4-5-7-16(15)23/h4-7,13-14H,8-12H2,1-3H3,(H2,24,30)/t14-/m0/s1 |
| InChIKey | PRALFWMZYDCYAL-AWEZNQCLSA-N |
| XLogP | 3.53 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |