C13H11Cl2N5 — CID 54051665
2-chloro-9-[(2-chlorophenyl)methyl]-N-methylpurin-6-amine (PubChem CID 54051665) has the molecular formula C13H11Cl2N5 and a molecular weight of 308.17 g/mol. Its IUPAC name is 2-chloro-9-[(2-chlorophenyl)methyl]-N-methylpurin-6-amine.
| Compound Name | 2-chloro-9-[(2-chlorophenyl)methyl]-N-methylpurin-6-amine |
|---|---|
| PubChem CID | 54051665 |
| Molecular Formula | C13H11Cl2N5 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-chloro-9-[(2-chlorophenyl)methyl]-N-methylpurin-6-amine |
| SMILES | CNc1nc(Cl)nc2c1ncn2Cc1ccccc1Cl |
| InChI | InChI=1S/C13H11Cl2N5/c1-16-11-10-12(19-13(15)18-11)20(7-17-10)6-8-4-2-3-5-9(8)14/h2-5,7H,6H2,1H3,(H,16,18,19) |
| InChIKey | LTHUYMPVCRZHDC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |