C13H10Cl2FN5 — CID 171621164
2-chloro-9-[(4-chloro-3-fluorophenyl)methyl]-N-methylpurin-6-amine (PubChem CID 171621164) has the molecular formula C13H10Cl2FN5 and a molecular weight of 326.16 g/mol. Its IUPAC name is 2-chloro-9-[(4-chloro-3-fluorophenyl)methyl]-N-methylpurin-6-amine.
| Compound Name | 2-chloro-9-[(4-chloro-3-fluorophenyl)methyl]-N-methylpurin-6-amine |
|---|---|
| PubChem CID | 171621164 |
| Molecular Formula | C13H10Cl2FN5 |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-chloro-9-[(4-chloro-3-fluorophenyl)methyl]-N-methylpurin-6-amine |
| SMILES | CNc1nc(Cl)nc2c1ncn2Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C13H10Cl2FN5/c1-17-11-10-12(20-13(15)19-11)21(6-18-10)5-7-2-3-8(14)9(16)4-7/h2-4,6H,5H2,1H3,(H,17,19,20) |
| InChIKey | FVDKRQYJSWMSBJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |