C20H16F3N5 — CID 139824135
N-methyl-9-[(4-phenylphenyl)methyl]-2-(trifluoromethyl)purin-6-amine (PubChem CID 139824135) has the molecular formula C20H16F3N5 and a molecular weight of 383.38 g/mol. Its IUPAC name is N-methyl-9-[(4-phenylphenyl)methyl]-2-(trifluoromethyl)purin-6-amine.
| Compound Name | N-methyl-9-[(4-phenylphenyl)methyl]-2-(trifluoromethyl)purin-6-amine |
|---|---|
| PubChem CID | 139824135 |
| Molecular Formula | C20H16F3N5 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-methyl-9-[(4-phenylphenyl)methyl]-2-(trifluoromethyl)purin-6-amine |
| SMILES | CNc1nc(C(F)(F)F)nc2c1ncn2Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16F3N5/c1-24-17-16-18(27-19(26-17)20(21,22)23)28(12-25-16)11-13-7-9-15(10-8-13)14-5-3-2-4-6-14/h2-10,12H,11H2,1H3,(H,24,26,27) |
| InChIKey | UNRXBKDRDIYIGD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |