C16H23N9O — CID 134518362
(3S)-1-[2-tert-butyl-9-[(5-methyltetrazol-5-yl)methyl]purin-6-yl]pyrrolidin-3-ol (PubChem CID 134518362) has the molecular formula C16H23N9O and a molecular weight of 357.42 g/mol. Its IUPAC name is (3S)-1-[2-tert-butyl-9-[(5-methyltetrazol-5-yl)methyl]purin-6-yl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[2-tert-butyl-9-[(5-methyltetrazol-5-yl)methyl]purin-6-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 134518362 |
| Molecular Formula | C16H23N9O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | (3S)-1-[2-tert-butyl-9-[(5-methyltetrazol-5-yl)methyl]purin-6-yl]pyrrolidin-3-ol |
| SMILES | CC1(Cn2cnc3c(N4CC[C@H](O)C4)nc(C(C)(C)C)nc32)N=NN=N1 |
| InChI | InChI=1S/C16H23N9O/c1-15(2,3)14-18-12(24-6-5-10(26)7-24)11-13(19-14)25(9-17-11)8-16(4)20-22-23-21-16/h9-10,26H,5-8H2,1-4H3/t10-/m0/s1 |
| InChIKey | WTQXYHLISKMTTA-JTQLQIEISA-N |
| XLogP | 2.24 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |