C14H20N4O — CID 129170820
1-(2-tert-butyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-ol (PubChem CID 129170820) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-(2-tert-butyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-ol.
| Compound Name | 1-(2-tert-butyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129170820 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-(2-tert-butyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-ol |
| SMILES | CC(C)(C)c1nc(N2CCC(O)C2)c2cc[nH]c2n1 |
| InChI | InChI=1S/C14H20N4O/c1-14(2,3)13-16-11-10(4-6-15-11)12(17-13)18-7-5-9(19)8-18/h4,6,9,19H,5,7-8H2,1-3H3,(H,15,16,17) |
| InChIKey | RJUNXESEEONDGK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |