C20H21F2N7S — CID 150363668
5-butyl-7-(3,3-difluoropyrrolidin-1-yl)-3-[(2-isothiocyanatophenyl)methyl]triazolo[4,5-d]pyrimidine (PubChem CID 150363668) has the molecular formula C20H21F2N7S and a molecular weight of 429.50 g/mol. Its IUPAC name is 5-butyl-7-(3,3-difluoropyrrolidin-1-yl)-3-[(2-isothiocyanatophenyl)methyl]triazolo[4,5-d]pyrimidine.
| Compound Name | 5-butyl-7-(3,3-difluoropyrrolidin-1-yl)-3-[(2-isothiocyanatophenyl)methyl]triazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 150363668 |
| Molecular Formula | C20H21F2N7S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 5-butyl-7-(3,3-difluoropyrrolidin-1-yl)-3-[(2-isothiocyanatophenyl)methyl]triazolo[4,5-d]pyrimidine |
| SMILES | CCCCc1nc(N2CCC(F)(F)C2)c2nnn(Cc3ccccc3N=C=S)c2n1 |
| InChI | InChI=1S/C20H21F2N7S/c1-2-3-8-16-24-18(28-10-9-20(21,22)12-28)17-19(25-16)29(27-26-17)11-14-6-4-5-7-15(14)23-13-30/h4-7H,2-3,8-12H2,1H3 |
| InChIKey | GWFYFEUKFVNUGO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|