C15H16ClN5 — CID 152530328
5-butyl-3-[(2-chlorophenyl)methyl]triazolo[4,5-d]pyrimidine (PubChem CID 152530328) has the molecular formula C15H16ClN5 and a molecular weight of 301.78 g/mol. Its IUPAC name is 5-butyl-3-[(2-chlorophenyl)methyl]triazolo[4,5-d]pyrimidine.
| Compound Name | 5-butyl-3-[(2-chlorophenyl)methyl]triazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 152530328 |
| Molecular Formula | C15H16ClN5 |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 5-butyl-3-[(2-chlorophenyl)methyl]triazolo[4,5-d]pyrimidine |
| SMILES | CCCCc1ncc2nnn(Cc3ccccc3Cl)c2n1 |
| InChI | InChI=1S/C15H16ClN5/c1-2-3-8-14-17-9-13-15(18-14)21(20-19-13)10-11-6-4-5-7-12(11)16/h4-7,9H,2-3,8,10H2,1H3 |
| InChIKey | YJKDCZLPIBOXFJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |