About 9-benzyl-2-pentylpurine
9-benzyl-2-pentylpurine (PubChem CID 54073118) has the molecular formula C17H20N4
and a molecular weight of 280.38 g/mol. Its IUPAC name is 9-benzyl-2-pentylpurine.
Molecular Properties
| Compound Name | 9-benzyl-2-pentylpurine |
| PubChem CID | 54073118 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 9-benzyl-2-pentylpurine |
| SMILES | CCCCCc1ncc2ncn(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C17H20N4/c1-2-3-5-10-16-18-11-15-17(20-16)21(13-19-15)12-14-8-6-4-7-9-14/h4,6-9,11,13H,2-3,5,10,12H2,1H3 |
| InChIKey | USTXAAUAXXZFAS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-benzyl-2-pentylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-2-pentylpurine?
The IUPAC name of 9-benzyl-2-pentylpurine (CID 54073118) is 9-benzyl-2-pentylpurine.
What is the SMILES notation for 9-benzyl-2-pentylpurine?
The canonical SMILES for 9-benzyl-2-pentylpurine is CCCCCc1ncc2ncn(Cc3ccccc3)c2n1.
What is the InChIKey of 9-benzyl-2-pentylpurine?
The InChIKey is USTXAAUAXXZFAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4/c1-2-3-5-10-16-18-11-15-17(20-16)21(13-19-15)12-14-8-6-4-7-9-14/h4,6-9,11,13H,2-3,5,10,12H2,1H3.
What are the key properties of 9-benzyl-2-pentylpurine?
9-benzyl-2-pentylpurine has a molecular weight of 280.38 g/mol, XLogP of 3.61, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-2-pentylpurine is sourced from PubChem (CID 54073118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).