C11H10ClN7 — CID 11780774
[3-[(2-chlorophenyl)methyl]triazolo[4,5-d]pyrimidin-7-yl]hydrazine (PubChem CID 11780774) has the molecular formula C11H10ClN7 and a molecular weight of 275.70 g/mol. Its IUPAC name is [3-[(2-chlorophenyl)methyl]triazolo[4,5-d]pyrimidin-7-yl]hydrazine.
| Compound Name | [3-[(2-chlorophenyl)methyl]triazolo[4,5-d]pyrimidin-7-yl]hydrazine |
|---|---|
| PubChem CID | 11780774 |
| Molecular Formula | C11H10ClN7 |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | [3-[(2-chlorophenyl)methyl]triazolo[4,5-d]pyrimidin-7-yl]hydrazine |
| SMILES | NNc1ncnc2c1nnn2Cc1ccccc1Cl |
| InChI | InChI=1S/C11H10ClN7/c12-8-4-2-1-3-7(8)5-19-11-9(17-18-19)10(16-13)14-6-15-11/h1-4,6H,5,13H2,(H,14,15,16) |
| InChIKey | UGBLJYGTVRZKLW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|