About 3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine
3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 3228212) has the molecular formula C20H20N6
and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine |
| PubChem CID | 3228212 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CC(C)c1ccc(Nc2ncnc3c2nnn3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H20N6/c1-14(2)16-8-10-17(11-9-16)23-19-18-20(22-13-21-19)26(25-24-18)12-15-6-4-3-5-7-15/h3-11,13-14H,12H2,1-2H3,(H,21,22,23) |
| InChIKey | YESLHECIEFOXRZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of 3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine (CID 3228212) is 3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for 3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for 3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine is CC(C)c1ccc(Nc2ncnc3c2nnn3Cc2ccccc2)cc1.
What is the InChIKey of 3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is YESLHECIEFOXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N6/c1-14(2)16-8-10-17(11-9-16)23-19-18-20(22-13-21-19)26(25-24-18)12-15-6-4-3-5-7-15/h3-11,13-14H,12H2,1-2H3,(H,21,22,23).
What are the key properties of 3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine?
3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 344.42 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-N-(4-propan-2-ylphenyl)triazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 3228212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).