C14H15ClFN7 — CID 4638651
N'-[3-[(2-chloro-6-fluorophenyl)methyl]triazolo[4,5-d]pyrimidin-7-yl]propane-1,3-diamine (PubChem CID 4638651) has the molecular formula C14H15ClFN7 and a molecular weight of 335.77 g/mol. Its IUPAC name is N'-[3-[(2-chloro-6-fluorophenyl)methyl]triazolo[4,5-d]pyrimidin-7-yl]propane-1,3-diamine.
| Compound Name | N'-[3-[(2-chloro-6-fluorophenyl)methyl]triazolo[4,5-d]pyrimidin-7-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 4638651 |
| Molecular Formula | C14H15ClFN7 |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N'-[3-[(2-chloro-6-fluorophenyl)methyl]triazolo[4,5-d]pyrimidin-7-yl]propane-1,3-diamine |
| SMILES | NCCCNc1ncnc2c1nnn2Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C14H15ClFN7/c15-10-3-1-4-11(16)9(10)7-23-14-12(21-22-23)13(19-8-20-14)18-6-2-5-17/h1,3-4,8H,2,5-7,17H2,(H,18,19,20) |
| InChIKey | WYNLWAYMQFFFAU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|