C17H23N6O2P — CID 10833209
3-benzyl-N-[3-(dimethylphosphorylmethoxy)propyl]triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 10833209) has the molecular formula C17H23N6O2P and a molecular weight of 374.39 g/mol. Its IUPAC name is 3-benzyl-N-[3-(dimethylphosphorylmethoxy)propyl]triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-benzyl-N-[3-(dimethylphosphorylmethoxy)propyl]triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 10833209 |
| Molecular Formula | C17H23N6O2P |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 3-benzyl-N-[3-(dimethylphosphorylmethoxy)propyl]triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CP(C)(=O)COCCCNc1ncnc2c1nnn2Cc1ccccc1 |
| InChI | InChI=1S/C17H23N6O2P/c1-26(2,24)13-25-10-6-9-18-16-15-17(20-12-19-16)23(22-21-15)11-14-7-4-3-5-8-14/h3-5,7-8,12H,6,9-11,13H2,1-2H3,(H,18,19,20) |
| InChIKey | ZZEOHDXPFNJDNN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|