C21H24N6 — CID 43817507
N-(1-adamantyl)-3-benzyltriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 43817507) has the molecular formula C21H24N6 and a molecular weight of 360.47 g/mol. Its IUPAC name is N-(1-adamantyl)-3-benzyltriazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | N-(1-adamantyl)-3-benzyltriazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 43817507 |
| Molecular Formula | C21H24N6 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | N-(1-adamantyl)-3-benzyltriazolo[4,5-d]pyrimidin-7-amine |
| SMILES | c1ccc(Cn2nnc3c(NC45CC6CC(CC(C6)C4)C5)ncnc32)cc1 |
| InChI | InChI=1S/C21H24N6/c1-2-4-14(5-3-1)12-27-20-18(25-26-27)19(22-13-23-20)24-21-9-15-6-16(10-21)8-17(7-15)11-21/h1-5,13,15-17H,6-12H2,(H,22,23,24) |
| InChIKey | OCPUOXRXXFESPN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |