C21H17Cl3N6O2 — CID 162354807
(4-chlorophenyl)-[2,6-dichloro-4-[[7-(2-methoxyethylamino)triazolo[4,5-d]pyrimidin-3-yl]methyl]phenyl]methanone (PubChem CID 162354807) has the molecular formula C21H17Cl3N6O2 and a molecular weight of 491.77 g/mol. Its IUPAC name is (4-chlorophenyl)-[2,6-dichloro-4-[[7-(2-methoxyethylamino)triazolo[4,5-d]pyrimidin-3-yl]methyl]phenyl]methanone.
| Compound Name | (4-chlorophenyl)-[2,6-dichloro-4-[[7-(2-methoxyethylamino)triazolo[4,5-d]pyrimidin-3-yl]methyl]phenyl]methanone |
|---|---|
| PubChem CID | 162354807 |
| Molecular Formula | C21H17Cl3N6O2 |
| Molecular Weight | 491.77 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | (4-chlorophenyl)-[2,6-dichloro-4-[[7-(2-methoxyethylamino)triazolo[4,5-d]pyrimidin-3-yl]methyl]phenyl]methanone |
| SMILES | COCCNc1ncnc2c1nnn2Cc1cc(Cl)c(C(=O)c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H17Cl3N6O2/c1-32-7-6-25-20-18-21(27-11-26-20)30(29-28-18)10-12-8-15(23)17(16(24)9-12)19(31)13-2-4-14(22)5-3-13/h2-5,8-9,11H,6-7,10H2,1H3,(H,25,26,27) |
| InChIKey | UJFWWSZVKRWKMO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.77 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|