C18H21FN6O — CID 126468647
5-ethyl-3-[(4-fluorophenyl)methyl]-N-(2-prop-2-enoxyethyl)triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 126468647) has the molecular formula C18H21FN6O and a molecular weight of 356.41 g/mol. Its IUPAC name is 5-ethyl-3-[(4-fluorophenyl)methyl]-N-(2-prop-2-enoxyethyl)triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-ethyl-3-[(4-fluorophenyl)methyl]-N-(2-prop-2-enoxyethyl)triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 126468647 |
| Molecular Formula | C18H21FN6O |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 5-ethyl-3-[(4-fluorophenyl)methyl]-N-(2-prop-2-enoxyethyl)triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | C=CCOCCNc1nc(CC)nc2c1nnn2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FN6O/c1-3-10-26-11-9-20-17-16-18(22-15(4-2)21-17)25(24-23-16)12-13-5-7-14(19)8-6-13/h3,5-8H,1,4,9-12H2,2H3,(H,20,21,22) |
| InChIKey | AUSJEAFTJBLLCO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|