C19H29N7O2 — CID 10572295
5-(4,4-diethoxypiperidin-1-yl)-N,3-bis(prop-2-enyl)triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 10572295) has the molecular formula C19H29N7O2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 5-(4,4-diethoxypiperidin-1-yl)-N,3-bis(prop-2-enyl)triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-(4,4-diethoxypiperidin-1-yl)-N,3-bis(prop-2-enyl)triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 10572295 |
| Molecular Formula | C19H29N7O2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 5-(4,4-diethoxypiperidin-1-yl)-N,3-bis(prop-2-enyl)triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | C=CCNc1nc(N2CCC(OCC)(OCC)CC2)nc2c1nnn2CC=C |
| InChI | InChI=1S/C19H29N7O2/c1-5-11-20-16-15-17(26(12-6-2)24-23-15)22-18(21-16)25-13-9-19(10-14-25,27-7-3)28-8-4/h5-6H,1-2,7-14H2,3-4H3,(H,20,21,22) |
| InChIKey | KYAOBMXYFGXZFB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|