C13H22N6O — CID 6488389
6-morpholin-4-yl-2-N-propan-2-yl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine (PubChem CID 6488389) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is 6-morpholin-4-yl-2-N-propan-2-yl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-morpholin-4-yl-2-N-propan-2-yl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 6488389 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 6-morpholin-4-yl-2-N-propan-2-yl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(NC(C)C)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H22N6O/c1-4-5-14-11-16-12(15-10(2)3)18-13(17-11)19-6-8-20-9-7-19/h4,10H,1,5-9H2,2-3H3,(H2,14,15,16,17,18) |
| InChIKey | KCMAZSHDUPHWEF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|