C12H21N7O2 — CID 110178402
[4-morpholin-4-yl-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]methylurea (PubChem CID 110178402) has the molecular formula C12H21N7O2 and a molecular weight of 295.35 g/mol. Its IUPAC name is [4-morpholin-4-yl-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]methylurea.
| Compound Name | [4-morpholin-4-yl-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]methylurea |
|---|---|
| PubChem CID | 110178402 |
| Molecular Formula | C12H21N7O2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | [4-morpholin-4-yl-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]methylurea |
| SMILES | CC(C)Nc1nc(CNC(N)=O)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C12H21N7O2/c1-8(2)15-11-16-9(7-14-10(13)20)17-12(18-11)19-3-5-21-6-4-19/h8H,3-7H2,1-2H3,(H3,13,14,20)(H,15,16,17,18) |
| InChIKey | QNLIQIZLQNPNEW-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |