C17H22N6O2 — CID 3146893
2-N-(4-methoxyphenyl)-6-morpholin-4-yl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine (PubChem CID 3146893) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-N-(4-methoxyphenyl)-6-morpholin-4-yl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-methoxyphenyl)-6-morpholin-4-yl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3146893 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2-N-(4-methoxyphenyl)-6-morpholin-4-yl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(Nc2ccc(OC)cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H22N6O2/c1-3-8-18-15-20-16(19-13-4-6-14(24-2)7-5-13)22-17(21-15)23-9-11-25-12-10-23/h3-7H,1,8-12H2,2H3,(H2,18,19,20,21,22) |
| InChIKey | KYPQNUNKJUIRIK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|