C31H35N7O — CID 54098309
2-[4-[6,11-dihydrobenzo[c][1]benzoxepin-11-yl(methyl)amino]piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-6-amine (PubChem CID 54098309) has the molecular formula C31H35N7O and a molecular weight of 521.67 g/mol. Its IUPAC name is 2-[4-[6,11-dihydrobenzo[c][1]benzoxepin-11-yl(methyl)amino]piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-6-amine.
| Compound Name | 2-[4-[6,11-dihydrobenzo[c][1]benzoxepin-11-yl(methyl)amino]piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-6-amine |
|---|---|
| PubChem CID | 54098309 |
| Molecular Formula | C31H35N7O |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | 2-[4-[6,11-dihydrobenzo[c][1]benzoxepin-11-yl(methyl)amino]piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-6-amine |
| SMILES | C=CCNc1nc(N2CCC(N(C)C3c4ccccc4COc4ccccc43)CC2)nc2c1ncn2CC=C |
| InChI | InChI=1S/C31H35N7O/c1-4-16-32-29-27-30(38(17-5-2)21-33-27)35-31(34-29)37-18-14-23(15-19-37)36(3)28-24-11-7-6-10-22(24)20-39-26-13-9-8-12-25(26)28/h4-13,21,23,28H,1-2,14-20H2,3H3,(H,32,34,35) |
| InChIKey | MYSNJRHZIZVVIS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|