C9H9Br2ClN2 — CID 58269933
4,6-dibromo-2-chloro-5-methyl-N-prop-2-enylpyridin-3-amine (PubChem CID 58269933) has the molecular formula C9H9Br2ClN2 and a molecular weight of 340.45 g/mol. Its IUPAC name is 4,6-dibromo-2-chloro-5-methyl-N-prop-2-enylpyridin-3-amine.
| Compound Name | 4,6-dibromo-2-chloro-5-methyl-N-prop-2-enylpyridin-3-amine |
|---|---|
| PubChem CID | 58269933 |
| Molecular Formula | C9H9Br2ClN2 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 337.88 |
| IUPAC Name | 4,6-dibromo-2-chloro-5-methyl-N-prop-2-enylpyridin-3-amine |
| SMILES | C=CCNc1c(Cl)nc(Br)c(C)c1Br |
| InChI | InChI=1S/C9H9Br2ClN2/c1-3-4-13-7-6(10)5(2)8(11)14-9(7)12/h3,13H,1,4H2,2H3 |
| InChIKey | FJKFYRJXBQATSO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|