C5H5Cl2N3O — CID 86014739
3,5-dichloro-6-methoxypyrazin-2-amine (PubChem CID 86014739) has the molecular formula C5H5Cl2N3O and a molecular weight of 194.02 g/mol. Its IUPAC name is 3,5-dichloro-6-methoxypyrazin-2-amine.
| Compound Name | 3,5-dichloro-6-methoxypyrazin-2-amine |
|---|---|
| PubChem CID | 86014739 |
| Molecular Formula | C5H5Cl2N3O |
| Molecular Weight | 194.02 g/mol |
| Exact Mass | 192.98 |
| IUPAC Name | 3,5-dichloro-6-methoxypyrazin-2-amine |
| SMILES | COc1nc(N)c(Cl)nc1Cl |
| InChI | InChI=1S/C5H5Cl2N3O/c1-11-5-3(7)9-2(6)4(8)10-5/h1H3,(H2,8,10) |
| InChIKey | UIPIPCDXCDADOL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.02 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |