C3H3ClN2O2 — CID 112571823
3-chloro-5-methoxy-1,2,4-oxadiazole (PubChem CID 112571823) has the molecular formula C3H3ClN2O2 and a molecular weight of 134.52 g/mol. Its IUPAC name is 3-chloro-5-methoxy-1,2,4-oxadiazole.
| Compound Name | 3-chloro-5-methoxy-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 112571823 |
| Molecular Formula | C3H3ClN2O2 |
| Molecular Weight | 134.52 g/mol |
| Exact Mass | 133.99 |
| IUPAC Name | 3-chloro-5-methoxy-1,2,4-oxadiazole |
| SMILES | COc1nc(Cl)no1 |
| InChI | InChI=1S/C3H3ClN2O2/c1-7-3-5-2(4)6-8-3/h1H3 |
| InChIKey | PSKWXLVQBBLFON-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.52 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |