About 2-methoxy-1-(5-methoxy-1,2,4-oxadiazol-3-yl)ethanamine
2-methoxy-1-(5-methoxy-1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 104633601) has the molecular formula C6H11N3O3
and a molecular weight of 173.17 g/mol. Its IUPAC name is 2-methoxy-1-(5-methoxy-1,2,4-oxadiazol-3-yl)ethanamine.
Analyze 2-methoxy-1-(5-methoxy-1,2,4-oxadiazol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-(5-methoxy-1,2,4-oxadiazol-3-yl)ethanamine?
The IUPAC name of 2-methoxy-1-(5-methoxy-1,2,4-oxadiazol-3-yl)ethanamine (CID 104633601) is 2-methoxy-1-(5-methoxy-1,2,4-oxadiazol-3-yl)ethanamine.
What is the SMILES notation for 2-methoxy-1-(5-methoxy-1,2,4-oxadiazol-3-yl)ethanamine?
The canonical SMILES for 2-methoxy-1-(5-methoxy-1,2,4-oxadiazol-3-yl)ethanamine is COCC(N)c1noc(OC)n1.
What is the InChIKey of 2-methoxy-1-(5-methoxy-1,2,4-oxadiazol-3-yl)ethanamine?
The InChIKey is WVFAZAQNNBCVNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O3/c1-10-3-4(7)5-8-6(11-2)12-9-5/h4H,3,7H2,1-2H3.
What are the key properties of 2-methoxy-1-(5-methoxy-1,2,4-oxadiazol-3-yl)ethanamine?
2-methoxy-1-(5-methoxy-1,2,4-oxadiazol-3-yl)ethanamine has a molecular weight of 173.17 g/mol, XLogP of -0.28, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-(5-methoxy-1,2,4-oxadiazol-3-yl)ethanamine is sourced from PubChem (CID 104633601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).