C5H7ClN2O2 — CID 102660924
3-(1-chloroethyl)-5-methoxy-1,2,4-oxadiazole (PubChem CID 102660924) has the molecular formula C5H7ClN2O2 and a molecular weight of 162.58 g/mol. Its IUPAC name is 3-(1-chloroethyl)-5-methoxy-1,2,4-oxadiazole.
| Compound Name | 3-(1-chloroethyl)-5-methoxy-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 102660924 |
| Molecular Formula | C5H7ClN2O2 |
| Molecular Weight | 162.58 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | 3-(1-chloroethyl)-5-methoxy-1,2,4-oxadiazole |
| SMILES | COc1nc(C(C)Cl)no1 |
| InChI | InChI=1S/C5H7ClN2O2/c1-3(6)4-7-5(9-2)10-8-4/h3H,1-2H3 |
| InChIKey | DIEZDOCBLMEJQL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.58 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|