C8H8ClN3O2 — CID 102660898
3-(1-chloroethyl)-5-(5-methyl-1,2-oxazol-4-yl)-1,2,4-oxadiazole (PubChem CID 102660898) has the molecular formula C8H8ClN3O2 and a molecular weight of 213.62 g/mol. Its IUPAC name is 3-(1-chloroethyl)-5-(5-methyl-1,2-oxazol-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chloroethyl)-5-(5-methyl-1,2-oxazol-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 102660898 |
| Molecular Formula | C8H8ClN3O2 |
| Molecular Weight | 213.62 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 3-(1-chloroethyl)-5-(5-methyl-1,2-oxazol-4-yl)-1,2,4-oxadiazole |
| SMILES | Cc1oncc1-c1nc(C(C)Cl)no1 |
| InChI | InChI=1S/C8H8ClN3O2/c1-4(9)7-11-8(14-12-7)6-3-10-13-5(6)2/h3-4H,1-2H3 |
| InChIKey | QHXPQOYVEKCMEG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.62 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|