C10H7Br2ClN2O — CID 107939307
3-(1-chloroethyl)-5-(2,4-dibromophenyl)-1,2,4-oxadiazole (PubChem CID 107939307) has the molecular formula C10H7Br2ClN2O and a molecular weight of 366.44 g/mol. Its IUPAC name is 3-(1-chloroethyl)-5-(2,4-dibromophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chloroethyl)-5-(2,4-dibromophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 107939307 |
| Molecular Formula | C10H7Br2ClN2O |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 363.86 |
| IUPAC Name | 3-(1-chloroethyl)-5-(2,4-dibromophenyl)-1,2,4-oxadiazole |
| SMILES | CC(Cl)c1noc(-c2ccc(Br)cc2Br)n1 |
| InChI | InChI=1S/C10H7Br2ClN2O/c1-5(13)9-14-10(16-15-9)7-3-2-6(11)4-8(7)12/h2-5H,1H3 |
| InChIKey | PSFVZFWKNSPTKR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|