C9H7Br2N3O — CID 107940651
[5-(2,4-dibromophenyl)-1,2,4-oxadiazol-3-yl]methanamine (PubChem CID 107940651) has the molecular formula C9H7Br2N3O and a molecular weight of 332.98 g/mol. Its IUPAC name is [5-(2,4-dibromophenyl)-1,2,4-oxadiazol-3-yl]methanamine.
| Compound Name | [5-(2,4-dibromophenyl)-1,2,4-oxadiazol-3-yl]methanamine |
|---|---|
| PubChem CID | 107940651 |
| Molecular Formula | C9H7Br2N3O |
| Molecular Weight | 332.98 g/mol |
| Exact Mass | 330.90 |
| IUPAC Name | [5-(2,4-dibromophenyl)-1,2,4-oxadiazol-3-yl]methanamine |
| SMILES | NCc1noc(-c2ccc(Br)cc2Br)n1 |
| InChI | InChI=1S/C9H7Br2N3O/c10-5-1-2-6(7(11)3-5)9-13-8(4-12)14-15-9/h1-3H,4,12H2 |
| InChIKey | MTPOAUIHRHQIAH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.98 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |