C10H6Cl2F2N2O — CID 102660981
5-(4-chloro-2,5-difluorophenyl)-3-(1-chloroethyl)-1,2,4-oxadiazole (PubChem CID 102660981) has the molecular formula C10H6Cl2F2N2O and a molecular weight of 279.07 g/mol. Its IUPAC name is 5-(4-chloro-2,5-difluorophenyl)-3-(1-chloroethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(4-chloro-2,5-difluorophenyl)-3-(1-chloroethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 102660981 |
| Molecular Formula | C10H6Cl2F2N2O |
| Molecular Weight | 279.07 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 5-(4-chloro-2,5-difluorophenyl)-3-(1-chloroethyl)-1,2,4-oxadiazole |
| SMILES | CC(Cl)c1noc(-c2cc(F)c(Cl)cc2F)n1 |
| InChI | InChI=1S/C10H6Cl2F2N2O/c1-4(11)9-15-10(17-16-9)5-2-8(14)6(12)3-7(5)13/h2-4H,1H3 |
| InChIKey | XZJVWZXZEMPLIO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.07 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|