C6H5ClN4OS — CID 102661119
3-(1-chloroethyl)-5-(thiadiazol-4-yl)-1,2,4-oxadiazole (PubChem CID 102661119) has the molecular formula C6H5ClN4OS and a molecular weight of 216.65 g/mol. Its IUPAC name is 3-(1-chloroethyl)-5-(thiadiazol-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chloroethyl)-5-(thiadiazol-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 102661119 |
| Molecular Formula | C6H5ClN4OS |
| Molecular Weight | 216.65 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | 3-(1-chloroethyl)-5-(thiadiazol-4-yl)-1,2,4-oxadiazole |
| SMILES | CC(Cl)c1noc(-c2csnn2)n1 |
| InChI | InChI=1S/C6H5ClN4OS/c1-3(7)5-8-6(12-10-5)4-2-13-11-9-4/h2-3H,1H3 |
| InChIKey | RCIFKCKFAHMVJS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.65 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|