C4HClN4OS — CID 112571871
3-chloro-5-(thiadiazol-4-yl)-1,2,4-oxadiazole (PubChem CID 112571871) has the molecular formula C4HClN4OS and a molecular weight of 188.60 g/mol. Its IUPAC name is 3-chloro-5-(thiadiazol-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-chloro-5-(thiadiazol-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 112571871 |
| Molecular Formula | C4HClN4OS |
| Molecular Weight | 188.60 g/mol |
| Exact Mass | 187.96 |
| IUPAC Name | 3-chloro-5-(thiadiazol-4-yl)-1,2,4-oxadiazole |
| SMILES | Clc1noc(-c2csnn2)n1 |
| InChI | InChI=1S/C4HClN4OS/c5-4-6-3(10-8-4)2-1-11-9-7-2/h1H |
| InChIKey | OXFSEOUCHASFCZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.60 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |